C39H72O6Si — CID 59840854
(9E)-4-[diethyl(propan-2-yl)silyl]oxy-8-hydroxy-12-[(2E,4E)-8-hydroxy-11-methoxy-6,6,9,10-tetramethyltrideca-2,4-dien-2-yl]-7,7,11-trimethyl-1-oxacyclododec-9-en-2-one (PubChem CID 59840854) has the molecular formula C39H72O6Si and a molecular weight of 665.09 g/mol. Its IUPAC name is (9E)-4-[diethyl(propan-2-yl)silyl]oxy-8-hydroxy-12-[(2E,4E)-8-hydroxy-11-methoxy-6,6,9,10-tetramethyltrideca-2,4-dien-2-yl]-7,7,11-trimethyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (9E)-4-[diethyl(propan-2-yl)silyl]oxy-8-hydroxy-12-[(2E,4E)-8-hydroxy-11-methoxy-6,6,9,10-tetramethyltrideca-2,4-dien-2-yl]-7,7,11-trimethyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 59840854 |
| Molecular Formula | C39H72O6Si |
| Molecular Weight | 665.09 g/mol |
| Exact Mass | 664.51 |
| IUPAC Name | (9E)-4-[diethyl(propan-2-yl)silyl]oxy-8-hydroxy-12-[(2E,4E)-8-hydroxy-11-methoxy-6,6,9,10-tetramethyltrideca-2,4-dien-2-yl]-7,7,11-trimethyl-1-oxacyclododec-9-en-2-one |
| SMILES | CCC(OC)C(C)C(C)C(O)CC(C)(C)/C=C/C=C(\C)C1OC(=O)CC(O[Si](CC)(CC)C(C)C)CCC(C)(C)C(O)/C=C/C1C |
| InChI | InChI=1S/C39H72O6Si/c1-15-34(43-14)31(9)30(8)33(40)26-38(10,11)23-18-19-28(6)37-29(7)20-21-35(41)39(12,13)24-22-32(25-36(42)44-37)45-46(16-2,17-3)27(4)5/h18-21,23,27,29-35,37,40-41H,15-17,22,24-26H2,1-14H3/b21-20+,23-18+,28-19+ |
| InChIKey | SKJAKTWVMHEYEE-HHGHZHAVSA-N |
| XLogP | 9.42 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.09 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|