C26H25N3OS2 — CID 59845634
N-[2-(3,3-diphenylprop-2-enylamino)ethyl]isoquinoline-5-sulfonothioamide (PubChem CID 59845634) has the molecular formula C26H25N3OS2 and a molecular weight of 459.64 g/mol. Its IUPAC name is N-[2-(3,3-diphenylprop-2-enylamino)ethyl]isoquinoline-5-sulfonothioamide.
| Compound Name | N-[2-(3,3-diphenylprop-2-enylamino)ethyl]isoquinoline-5-sulfonothioamide |
|---|---|
| PubChem CID | 59845634 |
| Molecular Formula | C26H25N3OS2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[2-(3,3-diphenylprop-2-enylamino)ethyl]isoquinoline-5-sulfonothioamide |
| SMILES | O=S(=S)(NCCNCC=C(c1ccccc1)c1ccccc1)c1cccc2cnccc12 |
| InChI | InChI=1S/C26H25N3OS2/c30-32(31,26-13-7-12-23-20-28-17-15-25(23)26)29-19-18-27-16-14-24(21-8-3-1-4-9-21)22-10-5-2-6-11-22/h1-15,17,20,27,29H,16,18-19H2 |
| InChIKey | KQSOLQCQWAFLMO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|