C38H38O8S3 — CID 59847016
2,2-dimethylpropyl 3-methyl-5-[[4-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]sulfonylphenyl]methyl]benzenesulfonate (PubChem CID 59847016) has the molecular formula C38H38O8S3 and a molecular weight of 718.92 g/mol. Its IUPAC name is 2,2-dimethylpropyl 3-methyl-5-[[4-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]sulfonylphenyl]methyl]benzenesulfonate.
| Compound Name | 2,2-dimethylpropyl 3-methyl-5-[[4-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]sulfonylphenyl]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 59847016 |
| Molecular Formula | C38H38O8S3 |
| Molecular Weight | 718.92 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | 2,2-dimethylpropyl 3-methyl-5-[[4-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]sulfonylphenyl]methyl]benzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(Oc3ccc(S(=O)(=O)c4ccc(Cc5cc(C)cc(S(=O)(=O)OCC(C)(C)C)c5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H38O8S3/c1-27-6-14-33(15-7-27)47(39,40)35-18-10-31(11-19-35)46-32-12-20-36(21-13-32)48(41,42)34-16-8-29(9-17-34)24-30-22-28(2)23-37(25-30)49(43,44)45-26-38(3,4)5/h6-23,25H,24,26H2,1-5H3 |
| InChIKey | YMULDTRYYAJTJZ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.92 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|