C20H22F2N6O5S — CID 59848465
N-[[(2S,3R,5R)-5-(6-aminopurin-9-yl)-3,4-dimethyloxolan-2-yl]methyl]-1,1-difluoro-2-(2-hydroxyphenyl)-2-oxoethanesulfonamide (PubChem CID 59848465) has the molecular formula C20H22F2N6O5S and a molecular weight of 496.50 g/mol. Its IUPAC name is N-[[(2S,3R,5R)-5-(6-aminopurin-9-yl)-3,4-dimethyloxolan-2-yl]methyl]-1,1-difluoro-2-(2-hydroxyphenyl)-2-oxoethanesulfonamide.
| Compound Name | N-[[(2S,3R,5R)-5-(6-aminopurin-9-yl)-3,4-dimethyloxolan-2-yl]methyl]-1,1-difluoro-2-(2-hydroxyphenyl)-2-oxoethanesulfonamide |
|---|---|
| PubChem CID | 59848465 |
| Molecular Formula | C20H22F2N6O5S |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | N-[[(2S,3R,5R)-5-(6-aminopurin-9-yl)-3,4-dimethyloxolan-2-yl]methyl]-1,1-difluoro-2-(2-hydroxyphenyl)-2-oxoethanesulfonamide |
| SMILES | CC1[C@@H](C)[C@@H](CNS(=O)(=O)C(F)(F)C(=O)c2ccccc2O)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H22F2N6O5S/c1-10-11(2)19(28-9-26-15-17(23)24-8-25-18(15)28)33-14(10)7-27-34(31,32)20(21,22)16(30)12-5-3-4-6-13(12)29/h3-6,8-11,14,19,27,29H,7H2,1-2H3,(H2,23,24,25)/t10-,11?,14-,19-/m1/s1 |
| InChIKey | HXEAGVPTBKHBSA-FOPBMRCOSA-N |
| XLogP | 1.68 |
| TPSA | 162.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |