C18H18F2N5O8P — CID 89355968
[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[1,1-difluoro-2-(2-hydroxyphenyl)-2-oxoethyl]phosphinic acid (PubChem CID 89355968) has the molecular formula C18H18F2N5O8P and a molecular weight of 501.34 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[1,1-difluoro-2-(2-hydroxyphenyl)-2-oxoethyl]phosphinic acid.
| Compound Name | [(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[1,1-difluoro-2-(2-hydroxyphenyl)-2-oxoethyl]phosphinic acid |
|---|---|
| PubChem CID | 89355968 |
| Molecular Formula | C18H18F2N5O8P |
| Molecular Weight | 501.34 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | [(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[1,1-difluoro-2-(2-hydroxyphenyl)-2-oxoethyl]phosphinic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)C(F)(F)C(=O)c2ccccc2O)C(O)[C@@H]1O |
| InChI | InChI=1S/C18H18F2N5O8P/c19-18(20,14(29)8-3-1-2-4-9(8)26)34(30,31)32-5-10-12(27)13(28)17(33-10)25-7-24-11-15(21)22-6-23-16(11)25/h1-4,6-7,10,12-13,17,26-28H,5H2,(H,30,31)(H2,21,22,23)/t10-,12?,13+,17-/m1/s1 |
| InChIKey | BBGAIFCZTYTOBK-LXAXPIHBSA-N |
| XLogP | 0.41 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|