C28H28F2N5O8P — CID 88911009
[(4R,6R,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-[1,1-difluoro-2-oxo-2-(2-phenylmethoxyphenyl)ethyl]phosphinic acid (PubChem CID 88911009) has the molecular formula C28H28F2N5O8P and a molecular weight of 631.53 g/mol. Its IUPAC name is [(4R,6R,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-[1,1-difluoro-2-oxo-2-(2-phenylmethoxyphenyl)ethyl]phosphinic acid.
| Compound Name | [(4R,6R,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-[1,1-difluoro-2-oxo-2-(2-phenylmethoxyphenyl)ethyl]phosphinic acid |
|---|---|
| PubChem CID | 88911009 |
| Molecular Formula | C28H28F2N5O8P |
| Molecular Weight | 631.53 g/mol |
| Exact Mass | 631.16 |
| IUPAC Name | [(4R,6R,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-[1,1-difluoro-2-oxo-2-(2-phenylmethoxyphenyl)ethyl]phosphinic acid |
| SMILES | CC1(C)OC2[C@@H](O1)[C@@H](COP(=O)(O)C(F)(F)C(=O)c1ccccc1OCc1ccccc1)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C28H28F2N5O8P/c1-27(2)42-21-19(41-26(22(21)43-27)35-15-34-20-24(31)32-14-33-25(20)35)13-40-44(37,38)28(29,30)23(36)17-10-6-7-11-18(17)39-12-16-8-4-3-5-9-16/h3-11,14-15,19,21-22,26H,12-13H2,1-2H3,(H,37,38)(H2,31,32,33)/t19-,21+,22?,26-/m1/s1 |
| InChIKey | TUGDPGLMWFARNN-VQNSDIELSA-N |
| XLogP | 4.08 |
| TPSA | 170.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|