C43H67ClN5O13 — CID 59866814
CID 59866814 (PubChem CID 59866814) has the molecular formula C43H67ClN5O13 and a molecular weight of 897.48 g/mol.
| Compound Name | CID 59866814 |
|---|---|
| PubChem CID | 59866814 |
| Molecular Formula | C43H67ClN5O13 |
| Molecular Weight | 897.48 g/mol |
| Exact Mass | 896.44 |
| IUPAC Name | — |
| SMILES | COC(=O)C(CCCC[NH])NC(=O)[C@H](Cc1ccc(OC(C)(C)C)cc1)NC(=O)[C@@H](CCCCNC(=O)C1OC(C)(C)OC1C1OC(C)(C)OC1C(=O)Cl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C43H67ClN5O13/c1-40(2,3)57-26-20-18-25(19-21-26)24-29(36(52)47-28(38(54)56-11)17-12-14-22-45)48-35(51)27(49-39(55)62-41(4,5)6)16-13-15-23-46-37(53)33-31(59-43(9,10)61-33)30-32(34(44)50)60-42(7,8)58-30/h18-21,27-33,45H,12-17,22-24H2,1-11H3,(H,46,53)(H,47,52)(H,48,51)(H,49,55)/t27-,28?,29+,30?,31?,32?,33?/m1/s1 |
| InChIKey | COUVBPUDCZBIHX-XSJYLYLTSA-N |
| XLogP | 3.99 |
| TPSA | 238.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|