C19H11IN5O8S2- — CID 59878189
[2-[2-(4-iodophenyl)-3-(4-nitrophenyl)tetrazol-3-ium-5-yl]-5-sulfinatooxyphenyl] sulfite (PubChem CID 59878189) has the molecular formula C19H11IN5O8S2- and a molecular weight of 628.36 g/mol. Its IUPAC name is [2-[2-(4-iodophenyl)-3-(4-nitrophenyl)tetrazol-3-ium-5-yl]-5-sulfinatooxyphenyl] sulfite.
| Compound Name | [2-[2-(4-iodophenyl)-3-(4-nitrophenyl)tetrazol-3-ium-5-yl]-5-sulfinatooxyphenyl] sulfite |
|---|---|
| PubChem CID | 59878189 |
| Molecular Formula | C19H11IN5O8S2- |
| Molecular Weight | 628.36 g/mol |
| Exact Mass | 627.91 |
| IUPAC Name | [2-[2-(4-iodophenyl)-3-(4-nitrophenyl)tetrazol-3-ium-5-yl]-5-sulfinatooxyphenyl] sulfite |
| SMILES | O=[N+]([O-])c1ccc(-[n+]2nc(-c3ccc(OS(=O)[O-])cc3OS(=O)[O-])nn2-c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C19H12IN5O8S2/c20-12-1-3-13(4-2-12)23-21-19(22-24(23)14-5-7-15(8-6-14)25(26)27)17-10-9-16(32-34(28)29)11-18(17)33-35(30)31/h1-11H,(H-,28,29,30,31)/p-1 |
| InChIKey | OMAODMGDSVHKGQ-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 176.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|