C22H40O2 — CID 59882927
(3E,5Z)-1-cyclohexyloxyhexadeca-3,5-dien-2-ol (PubChem CID 59882927) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is (3E,5Z)-1-cyclohexyloxyhexadeca-3,5-dien-2-ol.
| Compound Name | (3E,5Z)-1-cyclohexyloxyhexadeca-3,5-dien-2-ol |
|---|---|
| PubChem CID | 59882927 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | (3E,5Z)-1-cyclohexyloxyhexadeca-3,5-dien-2-ol |
| SMILES | CCCCCCCCCC/C=C\C=C\C(O)COC1CCCCC1 |
| InChI | InChI=1S/C22H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-14-17-21(23)20-24-22-18-15-13-16-19-22/h11-12,14,17,21-23H,2-10,13,15-16,18-20H2,1H3/b12-11-,17-14+ |
| InChIKey | OAQLZVMQNOQLKW-KMAOEOGZSA-N |
| XLogP | 6.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|