C36H26F6N2O5 — CID 59883088
5-[2-[5-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]-6-methyl-1,3-dioxoisoindol-5-yl]-2,6-dimethylisoindole-1,3-dione (PubChem CID 59883088) has the molecular formula C36H26F6N2O5 and a molecular weight of 680.60 g/mol. Its IUPAC name is 5-[2-[5-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]-6-methyl-1,3-dioxoisoindol-5-yl]-2,6-dimethylisoindole-1,3-dione.
| Compound Name | 5-[2-[5-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]-6-methyl-1,3-dioxoisoindol-5-yl]-2,6-dimethylisoindole-1,3-dione |
|---|---|
| PubChem CID | 59883088 |
| Molecular Formula | C36H26F6N2O5 |
| Molecular Weight | 680.60 g/mol |
| Exact Mass | 680.17 |
| IUPAC Name | 5-[2-[5-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]-6-methyl-1,3-dioxoisoindol-5-yl]-2,6-dimethylisoindole-1,3-dione |
| SMILES | Cc1ccc(C(c2ccc(O)c(N3C(=O)c4cc(C)c(-c5cc6c(cc5C)C(=O)N(C)C6=O)cc4C3=O)c2)(C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C36H26F6N2O5/c1-16-6-7-20(10-17(16)2)34(35(37,38)39,36(40,41)42)21-8-9-29(45)28(13-21)44-32(48)25-12-19(4)23(15-27(25)33(44)49)22-14-26-24(11-18(22)3)30(46)43(5)31(26)47/h6-15,45H,1-5H3 |
| InChIKey | YQZKPTONSXKQKS-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.60 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|