C30H41IO4S — CID 59887192
1-[[bis(4-tert-butylphenyl)-λ3-iodanyl]oxyperoxysulfanylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 59887192) has the molecular formula C30H41IO4S and a molecular weight of 624.63 g/mol. Its IUPAC name is 1-[[bis(4-tert-butylphenyl)-λ3-iodanyl]oxyperoxysulfanylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | 1-[[bis(4-tert-butylphenyl)-λ3-iodanyl]oxyperoxysulfanylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 59887192 |
| Molecular Formula | C30H41IO4S |
| Molecular Weight | 624.63 g/mol |
| Exact Mass | 624.18 |
| IUPAC Name | 1-[[bis(4-tert-butylphenyl)-λ3-iodanyl]oxyperoxysulfanylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC(C)(C)c1ccc(I(OOOSCC23CCC(CC2=O)C3(C)C)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H41IO4S/c1-27(2,3)21-9-13-24(14-10-21)31(25-15-11-22(12-16-25)28(4,5)6)33-34-35-36-20-30-18-17-23(19-26(30)32)29(30,7)8/h9-16,23H,17-20H2,1-8H3 |
| InChIKey | NXGNNPVTIFLRDQ-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.63 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|