C14H11ClF5N5O2 — CID 59889576
1-[4-[chloro(difluoro)methyl]-6-methyl-1,3,5-triazin-2-yl]-3-[[2-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 59889576) has the molecular formula C14H11ClF5N5O2 and a molecular weight of 411.72 g/mol. Its IUPAC name is 1-[4-[chloro(difluoro)methyl]-6-methyl-1,3,5-triazin-2-yl]-3-[[2-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-[4-[chloro(difluoro)methyl]-6-methyl-1,3,5-triazin-2-yl]-3-[[2-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 59889576 |
| Molecular Formula | C14H11ClF5N5O2 |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 1-[4-[chloro(difluoro)methyl]-6-methyl-1,3,5-triazin-2-yl]-3-[[2-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | Cc1nc(NC(=O)NCc2ccccc2OC(F)(F)F)nc(C(F)(F)Cl)n1 |
| InChI | InChI=1S/C14H11ClF5N5O2/c1-7-22-10(13(15,16)17)24-11(23-7)25-12(26)21-6-8-4-2-3-5-9(8)27-14(18,19)20/h2-5H,6H2,1H3,(H2,21,22,23,24,25,26) |
| InChIKey | IXDLLNPYKLJCPH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|