C27H20N4O2+2 — CID 59895363
(1R)-4-methyl-23-phenyl-2,24-dioxa-9,22-diaza-10,23-diazoniahexacyclo[15.6.2.111,15.01,10.03,8.021,25]hexacosa-3,5,7,9,11,13,15(26),17(25),18,20,22-undecaene (PubChem CID 59895363) has the molecular formula C27H20N4O2+2 and a molecular weight of 432.48 g/mol. Its IUPAC name is (1R)-4-methyl-23-phenyl-2,24-dioxa-9,22-diaza-10,23-diazoniahexacyclo[15.6.2.111,15.01,10.03,8.021,25]hexacosa-3,5,7,9,11,13,15(26),17(25),18,20,22-undecaene.
| Compound Name | (1R)-4-methyl-23-phenyl-2,24-dioxa-9,22-diaza-10,23-diazoniahexacyclo[15.6.2.111,15.01,10.03,8.021,25]hexacosa-3,5,7,9,11,13,15(26),17(25),18,20,22-undecaene |
|---|---|
| PubChem CID | 59895363 |
| Molecular Formula | C27H20N4O2+2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (1R)-4-methyl-23-phenyl-2,24-dioxa-9,22-diaza-10,23-diazoniahexacyclo[15.6.2.111,15.01,10.03,8.021,25]hexacosa-3,5,7,9,11,13,15(26),17(25),18,20,22-undecaene |
| SMILES | Cc1cccc2c1O[C@@]13Oc4c(cccc4N=[N+]1c1ccccc1)Cc1cccc(c1)[N+]3=N2 |
| InChI | InChI=1S/C27H20N4O2/c1-18-8-5-14-23-25(18)32-27-30(21-11-3-2-4-12-21)29-24-15-7-10-20(26(24)33-27)16-19-9-6-13-22(17-19)31(27)28-23/h2-15,17H,16H2,1H3/q+2/t27-/m1/s1 |
| InChIKey | OWSGSHLMLSLUEY-HHHXNRCGSA-N |
| XLogP | 6.85 |
| TPSA | 49.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|