C27H22N2O2+2 — CID 59909163
(2S)-4',8-dimethyl-3-phenylspiro[1,3-benzoxazin-3-ium-2,6'-pyrido[1,2-c][1,3]benzoxazin-7-ium] (PubChem CID 59909163) has the molecular formula C27H22N2O2+2 and a molecular weight of 406.49 g/mol. Its IUPAC name is (2S)-4',8-dimethyl-3-phenylspiro[1,3-benzoxazin-3-ium-2,6'-pyrido[1,2-c][1,3]benzoxazin-7-ium].
| Compound Name | (2S)-4',8-dimethyl-3-phenylspiro[1,3-benzoxazin-3-ium-2,6'-pyrido[1,2-c][1,3]benzoxazin-7-ium] |
|---|---|
| PubChem CID | 59909163 |
| Molecular Formula | C27H22N2O2+2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (2S)-4',8-dimethyl-3-phenylspiro[1,3-benzoxazin-3-ium-2,6'-pyrido[1,2-c][1,3]benzoxazin-7-ium] |
| SMILES | Cc1cccc2c1O[C@]1(Oc3c(C)cccc3-c3cccc[n+]31)[N+](c1ccccc1)=C2 |
| InChI | InChI=1S/C27H22N2O2/c1-19-10-8-12-21-18-29(22-13-4-3-5-14-22)27(30-25(19)21)28-17-7-6-16-24(28)23-15-9-11-20(2)26(23)31-27/h3-18H,1-2H3/q+2/t27-/m1/s1 |
| InChIKey | ZOQYRWHBMRZGJQ-HHHXNRCGSA-N |
| XLogP | 5.07 |
| TPSA | 25.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|