C15H21BrO2 — CID 59898695
(2S,3S)-6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene-2,3-diol (PubChem CID 59898695) has the molecular formula C15H21BrO2 and a molecular weight of 313.24 g/mol. Its IUPAC name is (2S,3S)-6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene-2,3-diol.
| Compound Name | (2S,3S)-6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 59898695 |
| Molecular Formula | C15H21BrO2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (2S,3S)-6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene-2,3-diol |
| SMILES | Cc1cc2c(cc1Br)C(C)(C)[C@H](O)[C@@H](O)C2(C)C |
| InChI | InChI=1S/C15H21BrO2/c1-8-6-9-10(7-11(8)16)15(4,5)13(18)12(17)14(9,2)3/h6-7,12-13,17-18H,1-5H3/t12-,13-/m1/s1 |
| InChIKey | AJSMSLFBWTVABI-CHWSQXEVSA-N |
| XLogP | 3.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |