C15H19Br — CID 10956849
6-bromo-1,1,4,4,7-pentamethylnaphthalene (PubChem CID 10956849) has the molecular formula C15H19Br and a molecular weight of 279.22 g/mol. Its IUPAC name is 6-bromo-1,1,4,4,7-pentamethylnaphthalene.
| Compound Name | 6-bromo-1,1,4,4,7-pentamethylnaphthalene |
|---|---|
| PubChem CID | 10956849 |
| Molecular Formula | C15H19Br |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 6-bromo-1,1,4,4,7-pentamethylnaphthalene |
| SMILES | Cc1cc2c(cc1Br)C(C)(C)C=CC2(C)C |
| InChI | InChI=1S/C15H19Br/c1-10-8-11-12(9-13(10)16)15(4,5)7-6-14(11,2)3/h6-9H,1-5H3 |
| InChIKey | NPVIBWATZCPDIH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|