C25H16Br6 — CID 132501777
4,5,11,12,18,19-hexabromo-1,8,15-trimethylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2,4,6,9,11,13,16,18,20-nonaene (PubChem CID 132501777) has the molecular formula C25H16Br6 and a molecular weight of 795.83 g/mol. Its IUPAC name is 4,5,11,12,18,19-hexabromo-1,8,15-trimethylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2,4,6,9,11,13,16,18,20-nonaene.
| Compound Name | 4,5,11,12,18,19-hexabromo-1,8,15-trimethylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2,4,6,9,11,13,16,18,20-nonaene |
|---|---|
| PubChem CID | 132501777 |
| Molecular Formula | C25H16Br6 |
| Molecular Weight | 795.83 g/mol |
| Exact Mass | 789.64 |
| IUPAC Name | 4,5,11,12,18,19-hexabromo-1,8,15-trimethylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2,4,6,9,11,13,16,18,20-nonaene |
| SMILES | C[C@]12c3cc(Br)c(Br)cc3[C@]3(C)c4cc(Br)c(Br)cc4[C@](C)(c4cc(Br)c(Br)cc41)C23 |
| InChI | InChI=1S/C25H16Br6/c1-23-10-4-16(26)18(28)6-12(10)24(2)14-8-20(30)21(31)9-15(14)25(3,22(23)24)13-7-19(29)17(27)5-11(13)23/h4-9,22H,1-3H3/t22?,23-,24+,25- |
| InChIKey | XQRBMJKNQIOHTM-RTTOYOBSSA-N |
| XLogP | 10.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.83 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |