C16H21BrO — CID 90076756
6-bromo-1,1,2,2,3,3-hexamethylindene-5-carbaldehyde (PubChem CID 90076756) has the molecular formula C16H21BrO and a molecular weight of 309.25 g/mol. Its IUPAC name is 6-bromo-1,1,2,2,3,3-hexamethylindene-5-carbaldehyde.
| Compound Name | 6-bromo-1,1,2,2,3,3-hexamethylindene-5-carbaldehyde |
|---|---|
| PubChem CID | 90076756 |
| Molecular Formula | C16H21BrO |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 6-bromo-1,1,2,2,3,3-hexamethylindene-5-carbaldehyde |
| SMILES | CC1(C)c2cc(Br)c(C=O)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H21BrO/c1-14(2)11-7-10(9-18)13(17)8-12(11)15(3,4)16(14,5)6/h7-9H,1-6H3 |
| InChIKey | PDAAGBMDTOBWRE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|