C18H27BrO3 — CID 69155443
(2R,3S)-6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene-2,3-diol;propan-2-one (PubChem CID 69155443) has the molecular formula C18H27BrO3 and a molecular weight of 371.32 g/mol. Its IUPAC name is (2R,3S)-6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene-2,3-diol;propan-2-one.
| Compound Name | (2R,3S)-6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene-2,3-diol;propan-2-one |
|---|---|
| PubChem CID | 69155443 |
| Molecular Formula | C18H27BrO3 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (2R,3S)-6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene-2,3-diol;propan-2-one |
| SMILES | CC(C)=O.Cc1cc2c(cc1Br)C(C)(C)[C@H](O)[C@H](O)C2(C)C |
| InChI | InChI=1S/C15H21BrO2.C3H6O/c1-8-6-9-10(7-11(8)16)15(4,5)13(18)12(17)14(9,2)3;1-3(2)4/h6-7,12-13,17-18H,1-5H3;1-2H3/t12-,13+;/m0./s1 |
| InChIKey | BBGPCJKHXXXTBF-JHEYCYPBSA-N |
| XLogP | 3.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |