C15H19BrO2 — CID 163112590
4-bromo-5-methyl-2-(1,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)phenol (PubChem CID 163112590) has the molecular formula C15H19BrO2 and a molecular weight of 311.22 g/mol. Its IUPAC name is 4-bromo-5-methyl-2-(1,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)phenol.
| Compound Name | 4-bromo-5-methyl-2-(1,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)phenol |
|---|---|
| PubChem CID | 163112590 |
| Molecular Formula | C15H19BrO2 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 4-bromo-5-methyl-2-(1,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)phenol |
| SMILES | Cc1cc(O)c(C2(C)CCC3(C)OC32C)cc1Br |
| InChI | InChI=1S/C15H19BrO2/c1-9-7-12(17)10(8-11(9)16)13(2)5-6-14(3)15(13,4)18-14/h7-8,17H,5-6H2,1-4H3 |
| InChIKey | QFRQSPJJVSZAOL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|