C21H40N6O3 — CID 59900098
(2S)-1-[(2R)-3-cyclohexyl-2-[ethyl(methyl)amino]propanoyl]-N-[2-(diaminomethylideneamino)oxyethyl]piperidine-2-carboxamide (PubChem CID 59900098) has the molecular formula C21H40N6O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is (2S)-1-[(2R)-3-cyclohexyl-2-[ethyl(methyl)amino]propanoyl]-N-[2-(diaminomethylideneamino)oxyethyl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-[(2R)-3-cyclohexyl-2-[ethyl(methyl)amino]propanoyl]-N-[2-(diaminomethylideneamino)oxyethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 59900098 |
| Molecular Formula | C21H40N6O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | (2S)-1-[(2R)-3-cyclohexyl-2-[ethyl(methyl)amino]propanoyl]-N-[2-(diaminomethylideneamino)oxyethyl]piperidine-2-carboxamide |
| SMILES | CCN(C)[C@H](CC1CCCCC1)C(=O)N1CCCC[C@H]1C(=O)NCCON=C(N)N |
| InChI | InChI=1S/C21H40N6O3/c1-3-26(2)18(15-16-9-5-4-6-10-16)20(29)27-13-8-7-11-17(27)19(28)24-12-14-30-25-21(22)23/h16-18H,3-15H2,1-2H3,(H,24,28)(H4,22,23,25)/t17-,18+/m0/s1 |
| InChIKey | HTGGQYMGBAGEET-ZWKOTPCHSA-N |
| XLogP | 0.98 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|