C26H32FN3O6S — CID 59905855
N-[[(5R)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-N-[(2,4,6-trimethoxyphenyl)methyl]ethanethioamide (PubChem CID 59905855) has the molecular formula C26H32FN3O6S and a molecular weight of 533.62 g/mol. Its IUPAC name is N-[[(5R)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-N-[(2,4,6-trimethoxyphenyl)methyl]ethanethioamide.
| Compound Name | N-[[(5R)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-N-[(2,4,6-trimethoxyphenyl)methyl]ethanethioamide |
|---|---|
| PubChem CID | 59905855 |
| Molecular Formula | C26H32FN3O6S |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | N-[[(5R)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-N-[(2,4,6-trimethoxyphenyl)methyl]ethanethioamide |
| SMILES | COc1cc(OC)c(CN(C[C@H]2CN(c3ccc(N4CCOCC4)c(F)c3)C(=O)O2)C(C)=S)c(OC)c1 |
| InChI | InChI=1S/C26H32FN3O6S/c1-17(37)29(16-21-24(33-3)12-19(32-2)13-25(21)34-4)14-20-15-30(26(31)36-20)18-5-6-23(22(27)11-18)28-7-9-35-10-8-28/h5-6,11-13,20H,7-10,14-16H2,1-4H3/t20-/m0/s1 |
| InChIKey | NCWBRPFEUVAKFW-FQEVSTJZSA-N |
| XLogP | 3.86 |
| TPSA | 72.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|