C19H36O3Si — CID 59906168
3-[(2R,3S,4R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-4-methyloxolan-3-yl]propanal (PubChem CID 59906168) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is 3-[(2R,3S,4R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-4-methyloxolan-3-yl]propanal.
| Compound Name | 3-[(2R,3S,4R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-4-methyloxolan-3-yl]propanal |
|---|---|
| PubChem CID | 59906168 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 3-[(2R,3S,4R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-4-methyloxolan-3-yl]propanal |
| SMILES | CC[C@@H](/C=C/[C@H]1OC[C@H](C)[C@@H]1CCC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-8-16(22-23(6,7)19(3,4)5)11-12-18-17(10-9-13-20)15(2)14-21-18/h11-13,15-18H,8-10,14H2,1-7H3/b12-11+/t15-,16-,17-,18+/m0/s1 |
| InChIKey | FROSNOKRKRLZLR-JJPQWZBKSA-N |
| XLogP | 4.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|