C17H12Cl4OS — CID 599109
2,6-bis(3,4-dichlorophenyl)thian-4-one (PubChem CID 599109) has the molecular formula C17H12Cl4OS and a molecular weight of 406.16 g/mol. Its IUPAC name is 2,6-bis(3,4-dichlorophenyl)thian-4-one.
| Compound Name | 2,6-bis(3,4-dichlorophenyl)thian-4-one |
|---|---|
| PubChem CID | 599109 |
| Molecular Formula | C17H12Cl4OS |
| Molecular Weight | 406.16 g/mol |
| Exact Mass | 403.94 |
| IUPAC Name | 2,6-bis(3,4-dichlorophenyl)thian-4-one |
| SMILES | O=C1CC(c2ccc(Cl)c(Cl)c2)SC(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C17H12Cl4OS/c18-12-3-1-9(5-14(12)20)16-7-11(22)8-17(23-16)10-2-4-13(19)15(21)6-10/h1-6,16-17H,7-8H2 |
| InChIKey | HNHWANVZPIUKQC-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.16 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |