C44H62O4 — CID 59911926
(S)-[(2S)-2-[(S)-hydroxy-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2-phenylethoxy]-[4-(4-pentylcyclohexyl)phenyl]methanol (PubChem CID 59911926) has the molecular formula C44H62O4 and a molecular weight of 654.98 g/mol. Its IUPAC name is (S)-[(2S)-2-[(S)-hydroxy-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2-phenylethoxy]-[4-(4-pentylcyclohexyl)phenyl]methanol.
| Compound Name | (S)-[(2S)-2-[(S)-hydroxy-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2-phenylethoxy]-[4-(4-pentylcyclohexyl)phenyl]methanol |
|---|---|
| PubChem CID | 59911926 |
| Molecular Formula | C44H62O4 |
| Molecular Weight | 654.98 g/mol |
| Exact Mass | 654.46 |
| IUPAC Name | (S)-[(2S)-2-[(S)-hydroxy-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2-phenylethoxy]-[4-(4-pentylcyclohexyl)phenyl]methanol |
| SMILES | CCCCCC1CCC(c2ccc([C@@H](O)OC[C@@H](O[C@H](O)c3ccc(C4CCC(CCCCC)CC4)cc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C44H62O4/c1-3-5-8-12-33-16-20-35(21-17-33)37-24-28-40(29-25-37)43(45)47-32-42(39-14-10-7-11-15-39)48-44(46)41-30-26-38(27-31-41)36-22-18-34(19-23-36)13-9-6-4-2/h7,10-11,14-15,24-31,33-36,42-46H,3-6,8-9,12-13,16-23,32H2,1-2H3/t33?,34?,35?,36?,42-,43+,44+/m1/s1 |
| InChIKey | YDSLAHNQHQWFIR-CWIUIXQUSA-N |
| XLogP | 11.85 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.98 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|