C20H30N2O5 — CID 59922396
1-[[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-3-ethyl-1-(2-phenylethyl)urea (PubChem CID 59922396) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-[[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-3-ethyl-1-(2-phenylethyl)urea.
| Compound Name | 1-[[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-3-ethyl-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 59922396 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1-[[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-3-ethyl-1-(2-phenylethyl)urea |
| SMILES | CCNC(=O)N(CCc1ccccc1)C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C20H30N2O5/c1-5-21-19(23)22(12-11-14-9-7-6-8-10-14)13-15-16(24-4)17-18(25-15)27-20(2,3)26-17/h6-10,15-18H,5,11-13H2,1-4H3,(H,21,23)/t15-,16+,17-,18-/m1/s1 |
| InChIKey | QAUXFRLPAPOOFK-XMTFNYHQSA-N |
| XLogP | 2.15 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |