C20H29N2O6+ — CID 59290343
[(3aR,4R,6R,6aR)-2-oxo-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylcarbamoyl-triethylazanium (PubChem CID 59290343) has the molecular formula C20H29N2O6+ and a molecular weight of 393.46 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-2-oxo-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylcarbamoyl-triethylazanium.
| Compound Name | [(3aR,4R,6R,6aR)-2-oxo-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylcarbamoyl-triethylazanium |
|---|---|
| PubChem CID | 59290343 |
| Molecular Formula | C20H29N2O6+ |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | [(3aR,4R,6R,6aR)-2-oxo-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylcarbamoyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)C(=O)NC[C@H]1O[C@@H](OCc2ccccc2)[C@@H]2OC(=O)O[C@@H]21 |
| InChI | InChI=1S/C20H28N2O6/c1-4-22(5-2,6-3)19(23)21-12-15-16-17(28-20(24)27-16)18(26-15)25-13-14-10-8-7-9-11-14/h7-11,15-18H,4-6,12-13H2,1-3H3/p+1/t15-,16-,17-,18-/m1/s1 |
| InChIKey | GFWXPCXTXLMUGZ-BRSBDYLESA-O |
| XLogP | 2.42 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|