C20H42O10Si3 — CID 59943363
3-[[[dimethoxy-[3-(2-methylprop-2-enylperoxy)propyl]silyl]oxy-dimethylsilyl]oxy-dimethoxysilyl]propyl 2-methylprop-2-enoate (PubChem CID 59943363) has the molecular formula C20H42O10Si3 and a molecular weight of 526.80 g/mol. Its IUPAC name is 3-[[[dimethoxy-[3-(2-methylprop-2-enylperoxy)propyl]silyl]oxy-dimethylsilyl]oxy-dimethoxysilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[[[dimethoxy-[3-(2-methylprop-2-enylperoxy)propyl]silyl]oxy-dimethylsilyl]oxy-dimethoxysilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59943363 |
| Molecular Formula | C20H42O10Si3 |
| Molecular Weight | 526.80 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 3-[[[dimethoxy-[3-(2-methylprop-2-enylperoxy)propyl]silyl]oxy-dimethylsilyl]oxy-dimethoxysilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)COOCCC[Si](OC)(OC)O[Si](C)(C)O[Si](CCCOC(=O)C(=C)C)(OC)OC |
| InChI | InChI=1S/C20H42O10Si3/c1-18(2)17-28-27-14-12-16-33(24-7,25-8)30-31(9,10)29-32(22-5,23-6)15-11-13-26-20(21)19(3)4/h1,3,11-17H2,2,4-10H3 |
| InChIKey | JQVOCTUUWPXLQA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|