C19H17N3O3 — CID 59943651
9-benzoyl-6-methyl-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione (PubChem CID 59943651) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 9-benzoyl-6-methyl-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione.
| Compound Name | 9-benzoyl-6-methyl-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 59943651 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 9-benzoyl-6-methyl-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2c2c1CCN(C(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C19H17N3O3/c1-11-9-15-16(21-18(24)17(23)20-15)14-10-22(8-7-13(11)14)19(25)12-5-3-2-4-6-12/h2-6,9H,7-8,10H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | FOQCGZHATSNBDE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|