C23H44O2 — CID 59944626
3-[3-(2-methoxy-2-methylbutyl)-3,5,5-trimethyloctyl]-7-oxabicyclo[4.1.0]heptane (PubChem CID 59944626) has the molecular formula C23H44O2 and a molecular weight of 352.60 g/mol. Its IUPAC name is 3-[3-(2-methoxy-2-methylbutyl)-3,5,5-trimethyloctyl]-7-oxabicyclo[4.1.0]heptane.
| Compound Name | 3-[3-(2-methoxy-2-methylbutyl)-3,5,5-trimethyloctyl]-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 59944626 |
| Molecular Formula | C23H44O2 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 352.33 |
| IUPAC Name | 3-[3-(2-methoxy-2-methylbutyl)-3,5,5-trimethyloctyl]-7-oxabicyclo[4.1.0]heptane |
| SMILES | CCCC(C)(C)CC(C)(CCC1CCC2OC2C1)CC(C)(CC)OC |
| InChI | InChI=1S/C23H44O2/c1-8-13-21(3,4)16-22(5,17-23(6,9-2)24-7)14-12-18-10-11-19-20(15-18)25-19/h18-20H,8-17H2,1-7H3 |
| InChIKey | OUGXMMCNCYURIT-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|