C27H56O3Si2 — CID 59938343
[8-methoxy-4,6,8-trimethyl-6-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-9-trimethylsilylnonan-4-yl]oxy-trimethylsilane (PubChem CID 59938343) has the molecular formula C27H56O3Si2 and a molecular weight of 484.91 g/mol. Its IUPAC name is [8-methoxy-4,6,8-trimethyl-6-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-9-trimethylsilylnonan-4-yl]oxy-trimethylsilane.
| Compound Name | [8-methoxy-4,6,8-trimethyl-6-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-9-trimethylsilylnonan-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 59938343 |
| Molecular Formula | C27H56O3Si2 |
| Molecular Weight | 484.91 g/mol |
| Exact Mass | 484.38 |
| IUPAC Name | [8-methoxy-4,6,8-trimethyl-6-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-9-trimethylsilylnonan-4-yl]oxy-trimethylsilane |
| SMILES | CCCC(C)(CC(C)(CCC1CCC2OC2C1)CC(C)(C[Si](C)(C)C)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C27H56O3Si2/c1-12-16-26(3,30-32(9,10)11)19-25(2,20-27(4,28-5)21-31(6,7)8)17-15-22-13-14-23-24(18-22)29-23/h22-24H,12-21H2,1-11H3 |
| InChIKey | OEFGVYVEIZXPFK-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.91 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|