C12H15N5O4S2 — CID 59945479
[(4-methyl-3-methylsulfanyl-5-oxo-1,2,4-triazole-1-carbonyl)amino] 2-(methylamino)benzenesulfinate (PubChem CID 59945479) has the molecular formula C12H15N5O4S2 and a molecular weight of 357.42 g/mol. Its IUPAC name is [(4-methyl-3-methylsulfanyl-5-oxo-1,2,4-triazole-1-carbonyl)amino] 2-(methylamino)benzenesulfinate.
| Compound Name | [(4-methyl-3-methylsulfanyl-5-oxo-1,2,4-triazole-1-carbonyl)amino] 2-(methylamino)benzenesulfinate |
|---|---|
| PubChem CID | 59945479 |
| Molecular Formula | C12H15N5O4S2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [(4-methyl-3-methylsulfanyl-5-oxo-1,2,4-triazole-1-carbonyl)amino] 2-(methylamino)benzenesulfinate |
| SMILES | CNc1ccccc1S(=O)ONC(=O)n1nc(SC)n(C)c1=O |
| InChI | InChI=1S/C12H15N5O4S2/c1-13-8-6-4-5-7-9(8)23(20)21-15-10(18)17-12(19)16(2)11(14-17)22-3/h4-7,13H,1-3H3,(H,15,18) |
| InChIKey | XYFXJBIGJXSAEU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|