C17H11BF2N2OS2 — CID 59950573
1-(2,2-difluoro-10,14-dithia-3-aza-1-azonia-2-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),4,6,8,11,15,17,19-octaen-12-yl)ethanone (PubChem CID 59950573) has the molecular formula C17H11BF2N2OS2 and a molecular weight of 372.23 g/mol. Its IUPAC name is 1-(2,2-difluoro-10,14-dithia-3-aza-1-azonia-2-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),4,6,8,11,15,17,19-octaen-12-yl)ethanone.
| Compound Name | 1-(2,2-difluoro-10,14-dithia-3-aza-1-azonia-2-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),4,6,8,11,15,17,19-octaen-12-yl)ethanone |
|---|---|
| PubChem CID | 59950573 |
| Molecular Formula | C17H11BF2N2OS2 |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 1-(2,2-difluoro-10,14-dithia-3-aza-1-azonia-2-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),4,6,8,11,15,17,19-octaen-12-yl)ethanone |
| SMILES | CC(=O)C1=C2Sc3ccccc3N2[B-](F)(F)[n+]2c1sc1ccccc12 |
| InChI | InChI=1S/C17H11BF2N2OS2/c1-10(23)15-16-21(11-6-2-4-8-13(11)24-16)18(19,20)22-12-7-3-5-9-14(12)25-17(15)22/h2-9H,1H3 |
| InChIKey | NLTIOPPVKDQLES-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|