C13H16O3 — CID 59955759
4-ethyl-5-hydroxy-3-oxatricyclo[6.2.2.02,7]dodeca-4,9-dien-6-one (PubChem CID 59955759) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 4-ethyl-5-hydroxy-3-oxatricyclo[6.2.2.02,7]dodeca-4,9-dien-6-one.
| Compound Name | 4-ethyl-5-hydroxy-3-oxatricyclo[6.2.2.02,7]dodeca-4,9-dien-6-one |
|---|---|
| PubChem CID | 59955759 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 4-ethyl-5-hydroxy-3-oxatricyclo[6.2.2.02,7]dodeca-4,9-dien-6-one |
| SMILES | CCC1=C(O)C(=O)C2C3C=CC(CC3)C2O1 |
| InChI | InChI=1S/C13H16O3/c1-2-9-11(14)12(15)10-7-3-5-8(6-4-7)13(10)16-9/h3,5,7-8,10,13-14H,2,4,6H2,1H3 |
| InChIKey | RLDCWAGCOYKVDB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|