About propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate
propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate (PubChem CID 59958131) has the molecular formula C27H44F2O5
and a molecular weight of 486.64 g/mol. Its IUPAC name is propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate.
Molecular Properties
| Compound Name | propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate |
| PubChem CID | 59958131 |
| Molecular Formula | C27H44F2O5 |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate |
| SMILES | CCCCCCC(F)(F)C(=O)/C=C/[C@H]1C(O)CC(=O)C1CCCCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C27H44F2O5/c1-4-5-6-13-18-27(28,29)25(32)17-16-22-21(23(30)19-24(22)31)14-11-9-7-8-10-12-15-26(33)34-20(2)3/h16-17,20-22,24,31H,4-15,18-19H2,1-3H3/b17-16+/t21?,22-,24?/m1/s1 |
| InChIKey | PCUIYAINNJFBCA-MPICJODFSA-N |
| XLogP | 6.36 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate?
The IUPAC name of propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate (CID 59958131) is propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate.
What is the SMILES notation for propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate?
The canonical SMILES for propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate is CCCCCCC(F)(F)C(=O)/C=C/[C@H]1C(O)CC(=O)C1CCCCCCCCC(=O)OC(C)C.
What is the InChIKey of propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate?
The InChIKey is PCUIYAINNJFBCA-MPICJODFSA-N. The full InChI is InChI=1S/C27H44F2O5/c1-4-5-6-13-18-27(28,29)25(32)17-16-22-21(23(30)19-24(22)31)14-11-9-7-8-10-12-15-26(33)34-20(2)3/h16-17,20-22,24,31H,4-15,18-19H2,1-3H3/b17-16+/t21?,22-,24?/m1/s1.
What are the key properties of propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate?
propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate has a molecular weight of 486.64 g/mol, XLogP of 6.36, 18 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 9-[(2R)-2-[(E)-4,4-difluoro-3-oxodec-1-enyl]-3-hydroxy-5-oxocyclopentyl]nonanoate is sourced from PubChem (CID 59958131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).