About 3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium
3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium (PubChem CID 59958250) has the molecular formula C12H20N2O3Y-2
and a molecular weight of 330.22 g/mol. Its IUPAC name is 3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium.
Molecular Properties
| Compound Name | 3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium |
| PubChem CID | 59958250 |
| Molecular Formula | C12H20N2O3Y-2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium |
| SMILES | C[C-]=O.[2H]C1C(=O)N(CC)CCN1C(=O)[C-](C)C.[Y] |
| InChI | InChI=1S/C10H17N2O2.C2H3O.Y/c1-4-11-5-6-12(7-9(11)13)10(14)8(2)3;1-2-3;/h4-7H2,1-3H3;1H3;/q2*-1;/i7D;; |
| InChIKey | LOPXQQSRUQAMMD-FMQXZSRCSA-N |
| XLogP | 0.40 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium?
The IUPAC name of 3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium (CID 59958250) is 3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium.
What is the SMILES notation for 3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium?
The canonical SMILES for 3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium is C[C-]=O.[2H]C1C(=O)N(CC)CCN1C(=O)[C-](C)C.[Y].
What is the InChIKey of 3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium?
The InChIKey is LOPXQQSRUQAMMD-FMQXZSRCSA-N. The full InChI is InChI=1S/C10H17N2O2.C2H3O.Y/c1-4-11-5-6-12(7-9(11)13)10(14)8(2)3;1-2-3;/h4-7H2,1-3H3;1H3;/q2*-1;/i7D;;.
What are the key properties of 3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium?
3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium has a molecular weight of 330.22 g/mol, XLogP of 0.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-deuterio-1-ethyl-4-(2-methylpropanoyl)piperazin-2-one;ethanone;yttrium is sourced from PubChem (CID 59958250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).