C26H32N2O2S — CID 59962875
5-tert-butyl-2-[5-(5-tert-butyl-2,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole (PubChem CID 59962875) has the molecular formula C26H32N2O2S and a molecular weight of 436.62 g/mol. Its IUPAC name is 5-tert-butyl-2-[5-(5-tert-butyl-2,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole.
| Compound Name | 5-tert-butyl-2-[5-(5-tert-butyl-2,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 59962875 |
| Molecular Formula | C26H32N2O2S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 5-tert-butyl-2-[5-(5-tert-butyl-2,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole |
| SMILES | CC(C)(C)c1ccc2oc(-c3ccc(C4N=C5CC(C(C)(C)C)CCC5O4)s3)nc2c1 |
| InChI | InChI=1S/C26H32N2O2S/c1-25(2,3)15-7-9-19-17(13-15)27-23(29-19)21-11-12-22(31-21)24-28-18-14-16(26(4,5)6)8-10-20(18)30-24/h7,9,11-13,16,20,24H,8,10,14H2,1-6H3 |
| InChIKey | HXKLTRFUTRXCCB-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 47.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |