C26H47BN2O8 — CID 59966919
CID 59966919 (PubChem CID 59966919) has the molecular formula C26H47BN2O8 and a molecular weight of 526.48 g/mol.
| Compound Name | CID 59966919 |
|---|---|
| PubChem CID | 59966919 |
| Molecular Formula | C26H47BN2O8 |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | — |
| SMILES | [B]C1CC(OC(=O)CCC(=O)NCCCCCCNC(=O)OCC(O)COCCCC(C)C)C(CC)O1 |
| InChI | InChI=1S/C26H47BN2O8/c1-4-21-22(16-23(27)36-21)37-25(32)12-11-24(31)28-13-7-5-6-8-14-29-26(33)35-18-20(30)17-34-15-9-10-19(2)3/h19-23,30H,4-18H2,1-3H3,(H,28,31)(H,29,33) |
| InChIKey | KHKNFDLPLSZSOE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|