About (1-carboxy-2-hydroxyethyl)azanide;platinum
(1-carboxy-2-hydroxyethyl)azanide;platinum (PubChem CID 59970240) has the molecular formula C3H6NO3Pt-
and a molecular weight of 299.16 g/mol. Its IUPAC name is (1-carboxy-2-hydroxyethyl)azanide;platinum.
Molecular Properties
| Compound Name | (1-carboxy-2-hydroxyethyl)azanide;platinum |
| PubChem CID | 59970240 |
| Molecular Formula | C3H6NO3Pt- |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | (1-carboxy-2-hydroxyethyl)azanide;platinum |
| SMILES | [NH-]C(CO)C(=O)O.[Pt] |
| InChI | InChI=1S/C3H6NO3.Pt/c4-2(1-5)3(6)7;/h2,4-5H,1H2,(H,6,7);/q-1; |
| InChIKey | ZDMBZLQWNKLTMU-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-carboxy-2-hydroxyethyl)azanide;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carboxy-2-hydroxyethyl)azanide;platinum?
The IUPAC name of (1-carboxy-2-hydroxyethyl)azanide;platinum (CID 59970240) is (1-carboxy-2-hydroxyethyl)azanide;platinum.
What is the SMILES notation for (1-carboxy-2-hydroxyethyl)azanide;platinum?
The canonical SMILES for (1-carboxy-2-hydroxyethyl)azanide;platinum is [NH-]C(CO)C(=O)O.[Pt].
What is the InChIKey of (1-carboxy-2-hydroxyethyl)azanide;platinum?
The InChIKey is ZDMBZLQWNKLTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6NO3.Pt/c4-2(1-5)3(6)7;/h2,4-5H,1H2,(H,6,7);/q-1;.
What are the key properties of (1-carboxy-2-hydroxyethyl)azanide;platinum?
(1-carboxy-2-hydroxyethyl)azanide;platinum has a molecular weight of 299.16 g/mol, XLogP of -0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carboxy-2-hydroxyethyl)azanide;platinum is sourced from PubChem (CID 59970240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).