About bis(2-azanidyl-3-hydroxypropanoate);palladium
bis(2-azanidyl-3-hydroxypropanoate);palladium (PubChem CID 138399124) has the molecular formula C6H10N2O6Pd-4
and a molecular weight of 312.57 g/mol. Its IUPAC name is bis(2-azanidyl-3-hydroxypropanoate);palladium.
Molecular Properties
| Compound Name | bis(2-azanidyl-3-hydroxypropanoate);palladium |
| PubChem CID | 138399124 |
| Molecular Formula | C6H10N2O6Pd-4 |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | bis(2-azanidyl-3-hydroxypropanoate);palladium |
| SMILES | [NH-]C(CO)C(=O)[O-].[NH-]C(CO)C(=O)[O-].[Pd] |
| InChI | InChI=1S/2C3H6NO3.Pd/c2*4-2(1-5)3(6)7;/h2*2,4-5H,1H2,(H,6,7);/q2*-1;/p-2 |
| InChIKey | ULAMSQULZJXMGF-UHFFFAOYSA-L |
| XLogP | -3.70 |
| TPSA | 168.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-azanidyl-3-hydroxypropanoate);palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-azanidyl-3-hydroxypropanoate);palladium?
The IUPAC name of bis(2-azanidyl-3-hydroxypropanoate);palladium (CID 138399124) is bis(2-azanidyl-3-hydroxypropanoate);palladium.
What is the SMILES notation for bis(2-azanidyl-3-hydroxypropanoate);palladium?
The canonical SMILES for bis(2-azanidyl-3-hydroxypropanoate);palladium is [NH-]C(CO)C(=O)[O-].[NH-]C(CO)C(=O)[O-].[Pd].
What is the InChIKey of bis(2-azanidyl-3-hydroxypropanoate);palladium?
The InChIKey is ULAMSQULZJXMGF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H6NO3.Pd/c2*4-2(1-5)3(6)7;/h2*2,4-5H,1H2,(H,6,7);/q2*-1;/p-2.
What are the key properties of bis(2-azanidyl-3-hydroxypropanoate);palladium?
bis(2-azanidyl-3-hydroxypropanoate);palladium has a molecular weight of 312.57 g/mol, XLogP of -3.70, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-azanidyl-3-hydroxypropanoate);palladium is sourced from PubChem (CID 138399124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).