C7H12N2 — CID 59970458
2-(deuteriomethyl)-1,4,5-trimethylimidazole (PubChem CID 59970458) has the molecular formula C7H12N2 and a molecular weight of 125.19 g/mol. Its IUPAC name is 2-(deuteriomethyl)-1,4,5-trimethylimidazole.
| Compound Name | 2-(deuteriomethyl)-1,4,5-trimethylimidazole |
|---|---|
| PubChem CID | 59970458 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 125.19 g/mol |
| Exact Mass | 125.11 |
| IUPAC Name | 2-(deuteriomethyl)-1,4,5-trimethylimidazole |
| SMILES | [2H]Cc1nc(C)c(C)n1C |
| InChI | InChI=1S/C7H12N2/c1-5-6(2)9(4)7(3)8-5/h1-4H3/i3D |
| InChIKey | WLUJHMKCLOIRSK-WFVSFCRTSA-N |
| XLogP | 1.35 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |