About methyl-(1,4,5-trimethylimidazol-2-yl)diazene
methyl-(1,4,5-trimethylimidazol-2-yl)diazene (PubChem CID 118299373) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is methyl-(1,4,5-trimethylimidazol-2-yl)diazene.
Molecular Properties
| Compound Name | methyl-(1,4,5-trimethylimidazol-2-yl)diazene |
| PubChem CID | 118299373 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | methyl-(1,4,5-trimethylimidazol-2-yl)diazene |
| SMILES | C/N=N/c1nc(C)c(C)n1C |
| InChI | InChI=1S/C7H12N4/c1-5-6(2)11(4)7(9-5)10-8-3/h1-4H3/b10-8+ |
| InChIKey | AYJWBTCBBAEZET-CSKARUKUSA-N |
| XLogP | 1.75 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl-(1,4,5-trimethylimidazol-2-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(1,4,5-trimethylimidazol-2-yl)diazene?
The IUPAC name of methyl-(1,4,5-trimethylimidazol-2-yl)diazene (CID 118299373) is methyl-(1,4,5-trimethylimidazol-2-yl)diazene.
What is the SMILES notation for methyl-(1,4,5-trimethylimidazol-2-yl)diazene?
The canonical SMILES for methyl-(1,4,5-trimethylimidazol-2-yl)diazene is C/N=N/c1nc(C)c(C)n1C.
What is the InChIKey of methyl-(1,4,5-trimethylimidazol-2-yl)diazene?
The InChIKey is AYJWBTCBBAEZET-CSKARUKUSA-N. The full InChI is InChI=1S/C7H12N4/c1-5-6(2)11(4)7(9-5)10-8-3/h1-4H3/b10-8+.
What are the key properties of methyl-(1,4,5-trimethylimidazol-2-yl)diazene?
methyl-(1,4,5-trimethylimidazol-2-yl)diazene has a molecular weight of 152.20 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(1,4,5-trimethylimidazol-2-yl)diazene is sourced from PubChem (CID 118299373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).