C7H12N4 — CID 118299373
methyl-(1,4,5-trimethylimidazol-2-yl)diazene (PubChem CID 118299373) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is methyl-(1,4,5-trimethylimidazol-2-yl)diazene.
| Compound Name | methyl-(1,4,5-trimethylimidazol-2-yl)diazene |
|---|---|
| PubChem CID | 118299373 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | methyl-(1,4,5-trimethylimidazol-2-yl)diazene |
| SMILES | C/N=N/c1nc(C)c(C)n1C |
| InChI | InChI=1S/C7H12N4/c1-5-6(2)11(4)7(9-5)10-8-3/h1-4H3/b10-8+ |
| InChIKey | AYJWBTCBBAEZET-CSKARUKUSA-N |
| XLogP | 1.75 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|