C10H15N3 — CID 139297464
N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine (PubChem CID 139297464) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine.
| Compound Name | N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 139297464 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/Cc1nc(C)c(C)n1C |
| InChI | InChI=1S/C10H15N3/c1-5-6-11-7-10-12-8(2)9(3)13(10)4/h5-6H,1,7H2,2-4H3/b11-6+ |
| InChIKey | SIXZMOHZUVRKGQ-IZZDOVSWSA-N |
| XLogP | 1.79 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|