About N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine
N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine (PubChem CID 139297464) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine.
Molecular Properties
| Compound Name | N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine |
| PubChem CID | 139297464 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/Cc1nc(C)c(C)n1C |
| InChI | InChI=1S/C10H15N3/c1-5-6-11-7-10-12-8(2)9(3)13(10)4/h5-6H,1,7H2,2-4H3/b11-6+ |
| InChIKey | SIXZMOHZUVRKGQ-IZZDOVSWSA-N |
| XLogP | 1.79 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine?
The IUPAC name of N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine (CID 139297464) is N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine.
What is the SMILES notation for N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine?
The canonical SMILES for N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine is C=C/C=N/Cc1nc(C)c(C)n1C.
What is the InChIKey of N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine?
The InChIKey is SIXZMOHZUVRKGQ-IZZDOVSWSA-N. The full InChI is InChI=1S/C10H15N3/c1-5-6-11-7-10-12-8(2)9(3)13(10)4/h5-6H,1,7H2,2-4H3/b11-6+.
What are the key properties of N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine?
N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine has a molecular weight of 177.25 g/mol, XLogP of 1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,4,5-trimethylimidazol-2-yl)methyl]prop-2-en-1-imine is sourced from PubChem (CID 139297464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).