C6H9ClI2N2V — CID 159466578
2-chloro-1,4,5-trimethylimidazole;diiodovanadium (PubChem CID 159466578) has the molecular formula C6H9ClI2N2V and a molecular weight of 449.36 g/mol. Its IUPAC name is 2-chloro-1,4,5-trimethylimidazole;diiodovanadium.
| Compound Name | 2-chloro-1,4,5-trimethylimidazole;diiodovanadium |
|---|---|
| PubChem CID | 159466578 |
| Molecular Formula | C6H9ClI2N2V |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.80 |
| IUPAC Name | 2-chloro-1,4,5-trimethylimidazole;diiodovanadium |
| SMILES | Cc1nc(Cl)n(C)c1C.I[V]I |
| InChI | InChI=1S/C6H9ClN2.2HI.V/c1-4-5(2)9(3)6(7)8-4;;;/h1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | LVGKWVCODNYJRW-UHFFFAOYSA-L |
| XLogP | 3.46 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|