C9H22NP — CID 59972215
N,N-diethyl-2-(phosphanylmethyl)butan-1-amine (PubChem CID 59972215) has the molecular formula C9H22NP and a molecular weight of 175.26 g/mol. Its IUPAC name is N,N-diethyl-2-(phosphanylmethyl)butan-1-amine.
| Compound Name | N,N-diethyl-2-(phosphanylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 59972215 |
| Molecular Formula | C9H22NP |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.15 |
| IUPAC Name | N,N-diethyl-2-(phosphanylmethyl)butan-1-amine |
| SMILES | CCC(CP)CN(CC)CC |
| InChI | InChI=1S/C9H22NP/c1-4-9(8-11)7-10(5-2)6-3/h9H,4-8,11H2,1-3H3 |
| InChIKey | AQGDBLREGJAQCG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|