C26H31N3O3S — CID 59983620
2-[4-[4-(benzylcarbamoyl)-1-pentylimidazol-2-yl]phenyl]sulfanyl-2-methylpropanoic acid (PubChem CID 59983620) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is 2-[4-[4-(benzylcarbamoyl)-1-pentylimidazol-2-yl]phenyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-[4-[4-(benzylcarbamoyl)-1-pentylimidazol-2-yl]phenyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 59983620 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-[4-[4-(benzylcarbamoyl)-1-pentylimidazol-2-yl]phenyl]sulfanyl-2-methylpropanoic acid |
| SMILES | CCCCCn1cc(C(=O)NCc2ccccc2)nc1-c1ccc(SC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C26H31N3O3S/c1-4-5-9-16-29-18-22(24(30)27-17-19-10-7-6-8-11-19)28-23(29)20-12-14-21(15-13-20)33-26(2,3)25(31)32/h6-8,10-15,18H,4-5,9,16-17H2,1-3H3,(H,27,30)(H,31,32) |
| InChIKey | NNOPTSBDDZDLKX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|