C29H37N3O10 — CID 59984335
ethyl 2-[[(5R,5aS,6S,6aS,7R,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10,10a,12-pentahydroxy-5,5a-dimethyl-8,11-dioxo-5,6,6a,7-tetrahydrotetracen-2-yl]amino]butanoate (PubChem CID 59984335) has the molecular formula C29H37N3O10 and a molecular weight of 587.63 g/mol. Its IUPAC name is ethyl 2-[[(5R,5aS,6S,6aS,7R,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10,10a,12-pentahydroxy-5,5a-dimethyl-8,11-dioxo-5,6,6a,7-tetrahydrotetracen-2-yl]amino]butanoate.
| Compound Name | ethyl 2-[[(5R,5aS,6S,6aS,7R,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10,10a,12-pentahydroxy-5,5a-dimethyl-8,11-dioxo-5,6,6a,7-tetrahydrotetracen-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 59984335 |
| Molecular Formula | C29H37N3O10 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | ethyl 2-[[(5R,5aS,6S,6aS,7R,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10,10a,12-pentahydroxy-5,5a-dimethyl-8,11-dioxo-5,6,6a,7-tetrahydrotetracen-2-yl]amino]butanoate |
| SMILES | CCOC(=O)C(CC)Nc1ccc2c(c1O)C(O)=C1C(=O)[C@@]3(O)C(O)=C(C(N)=O)C(=O)[C@H](N(C)C)[C@H]3[C@H](O)[C@@]1(C)[C@@H]2C |
| InChI | InChI=1S/C29H37N3O10/c1-7-13(27(40)42-8-2)31-14-10-9-12-11(3)28(4)18(21(34)15(12)20(14)33)25(38)29(41)17(24(28)37)19(32(5)6)22(35)16(23(29)36)26(30)39/h9-11,13,17,19,24,31,33-34,36-37,41H,7-8H2,1-6H3,(H2,30,39)/t11-,13?,17+,19-,24+,28+,29+/m1/s1 |
| InChIKey | UUWXZYCUFLIPPU-DNVFRSDYSA-N |
| XLogP | 0.64 |
| TPSA | 219.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|