C29H37N7O9 — CID 59995364
ethyl 2-[[(5S,5aR,6S,6aS,7S,10aR)-5,5a,6a-triamino-9-carbamoyl-10a-cyano-7-(dimethylamino)-1,6,10,12-tetrahydroxy-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]amino]pentanoate (PubChem CID 59995364) has the molecular formula C29H37N7O9 and a molecular weight of 627.66 g/mol. Its IUPAC name is ethyl 2-[[(5S,5aR,6S,6aS,7S,10aR)-5,5a,6a-triamino-9-carbamoyl-10a-cyano-7-(dimethylamino)-1,6,10,12-tetrahydroxy-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]amino]pentanoate.
| Compound Name | ethyl 2-[[(5S,5aR,6S,6aS,7S,10aR)-5,5a,6a-triamino-9-carbamoyl-10a-cyano-7-(dimethylamino)-1,6,10,12-tetrahydroxy-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]amino]pentanoate |
|---|---|
| PubChem CID | 59995364 |
| Molecular Formula | C29H37N7O9 |
| Molecular Weight | 627.66 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | ethyl 2-[[(5S,5aR,6S,6aS,7S,10aR)-5,5a,6a-triamino-9-carbamoyl-10a-cyano-7-(dimethylamino)-1,6,10,12-tetrahydroxy-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]amino]pentanoate |
| SMILES | CCCC(Nc1ccc2c(c1O)C(O)=C1C(=O)[C@]3(C#N)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@]3(N)[C@@H](O)[C@]1(N)[C@H]2N)C(=O)OCC |
| InChI | InChI=1S/C29H37N7O9/c1-5-7-13(25(43)45-6-2)35-12-9-8-11-14(17(12)37)18(38)16-23(41)27(10-30)22(40)15(24(32)42)19(39)21(36(3)4)29(27,34)26(44)28(16,33)20(11)31/h8-9,13,20-21,26,35,37-38,40,44H,5-7,31,33-34H2,1-4H3,(H2,32,42)/t13?,20-,21+,26-,27-,28+,29-/m0/s1 |
| InChIKey | UASJFKURJNUPCG-ZOULTPECSA-N |
| XLogP | -1.52 |
| TPSA | 301.57 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.66 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|