C30H38N6O9 — CID 59995227
[4-[(5S,5aR,6S,6aS,7S,10aR)-5,5a,6a-triamino-9-carbamoyl-10a-cyano-7-(dimethylamino)-1,6,10,12-tetrahydroxy-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]-4-methylpentyl] acetate (PubChem CID 59995227) has the molecular formula C30H38N6O9 and a molecular weight of 626.67 g/mol. Its IUPAC name is [4-[(5S,5aR,6S,6aS,7S,10aR)-5,5a,6a-triamino-9-carbamoyl-10a-cyano-7-(dimethylamino)-1,6,10,12-tetrahydroxy-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]-4-methylpentyl] acetate.
| Compound Name | [4-[(5S,5aR,6S,6aS,7S,10aR)-5,5a,6a-triamino-9-carbamoyl-10a-cyano-7-(dimethylamino)-1,6,10,12-tetrahydroxy-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]-4-methylpentyl] acetate |
|---|---|
| PubChem CID | 59995227 |
| Molecular Formula | C30H38N6O9 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | [4-[(5S,5aR,6S,6aS,7S,10aR)-5,5a,6a-triamino-9-carbamoyl-10a-cyano-7-(dimethylamino)-1,6,10,12-tetrahydroxy-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]-4-methylpentyl] acetate |
| SMILES | CC(=O)OCCCC(C)(C)c1ccc2c(c1O)C(O)=C1C(=O)[C@]3(C#N)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@]3(N)[C@@H](O)[C@]1(N)[C@H]2N |
| InChI | InChI=1S/C30H38N6O9/c1-12(37)45-10-6-9-27(2,3)14-8-7-13-15(18(14)38)19(39)17-24(42)28(11-31)23(41)16(25(33)43)20(40)22(36(4)5)30(28,35)26(44)29(17,34)21(13)32/h7-8,21-22,26,38-39,41,44H,6,9-10,32,34-35H2,1-5H3,(H2,33,43)/t21-,22+,26-,28-,29+,30-/m0/s1 |
| InChIKey | SUNXLZARXTWXOA-LZLMCYBJSA-N |
| XLogP | -1.05 |
| TPSA | 289.54 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|