C13H26N2O4 — CID 59985910
6-(methoxyamino)-N-[2-(methoxymethyl)-5-tritiooxolan-3-yl]hexanamide (PubChem CID 59985910) has the molecular formula C13H26N2O4 and a molecular weight of 276.37 g/mol. Its IUPAC name is 6-(methoxyamino)-N-[2-(methoxymethyl)-5-tritiooxolan-3-yl]hexanamide.
| Compound Name | 6-(methoxyamino)-N-[2-(methoxymethyl)-5-tritiooxolan-3-yl]hexanamide |
|---|---|
| PubChem CID | 59985910 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 6-(methoxyamino)-N-[2-(methoxymethyl)-5-tritiooxolan-3-yl]hexanamide |
| SMILES | [3H]C1CC(NC(=O)CCCCCNOC)C(COC)O1 |
| InChI | InChI=1S/C13H26N2O4/c1-17-10-12-11(7-9-19-12)15-13(16)6-4-3-5-8-14-18-2/h11-12,14H,3-10H2,1-2H3,(H,15,16)/i9T |
| InChIKey | DFPIFYNKMUGQNL-FIRFLZKJSA-N |
| XLogP | 0.62 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|